CAS 131410-48-5 appears in our catalog under these names: Gadodiamide, Gadodiamide, >95% (HPLC), Gadodiamide/ 99.74% (existing batch purity). Offered by: Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: on request, 100mg, 500mg, 50mg, 10mM (in 1ml dmso).
2-[bis[2-[carboxylatomethyl-[2-(methylamino)-2-oxoethyl]amino]ethyl]amino]acetate;gadolinium(3+) (CAS 131410-48-5) is a chemical compound with the molecular formula C16H26GdN5O8 and a molecular weight of 573.66 g/mol. IUPAC name: 2-[bis[2-[carboxylatomethyl-[2-(methylamino)-2-oxoethyl]amino]ethyl]amino]acetate;gadolinium(3+). InChIKey: HZHFFEYYPYZMNU-UHFFFAOYSA-K.
| Molecular formula | C16H26GdN5O8 |
|---|---|
| Molecular weight | 573.66 g/mol |
| IUPAC name | 2-[bis[2-[carboxylatomethyl-[2-(methylamino)-2-oxoethyl]amino]ethyl]amino]acetate;gadolinium(3+) |
| InChIKey | HZHFFEYYPYZMNU-UHFFFAOYSA-K |
| SMILES | CNC(=O)CN(CCN(CCN(CC(=O)NC)CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[Gd+3] |
Computed by PubChem (NCBI)