CAS 1314118-94-9 appears in our catalog under these names: Mk2-in-1 (hydrochloride), 95%, MK2-IN-1 hydrochloride/ 99.67% (existing batch purity), MK2 Inhibitor IV, MK2-IN-1 hydrochloride, MK2-IN-1 (hydrochloride), 98.36%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25mg, 5mg, 10mg, 50mg, 100mg, 200mg, 5 mg, 10 mg.
5-(4-chlorophenyl)-N-(4-piperazin-1-ylphenyl)-N-(pyridin-2-ylmethyl)furan-2-carboxamide;hydrochloride (CAS 1314118-94-9) is a chemical compound with the molecular formula C27H26Cl2N4O2 and a molecular weight of 509.4 g/mol. IUPAC name: 5-(4-chlorophenyl)-N-(4-piperazin-1-ylphenyl)-N-(pyridin-2-ylmethyl)furan-2-carboxamide;hydrochloride. InChIKey: AZDOSXSDARWKGX-UHFFFAOYSA-N.
| Molecular formula | C27H26Cl2N4O2 |
|---|---|
| Molecular weight | 509.4 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-N-(4-piperazin-1-ylphenyl)-N-(pyridin-2-ylmethyl)furan-2-carboxamide;hydrochloride |
| InChIKey | AZDOSXSDARWKGX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)N(CC3=CC=CC=N3)C(=O)C4=CC=C(O4)C5=CC=C(C=C5)Cl.Cl |
Computed by PubChem (NCBI)