Products 1314216-33-5

CAS 1314216-33-5 appears in our catalog under these names: (2H-Pyrazol-3-yl)boronic acid hydrochloride, 95%, Pyrazole-3-boronic acid hydrochloride, 98%, (1H–Pyrazol–3–yl)boronic acid hydrochloride, (1H-Pyrazol-3-yl)boronic acid hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

1H-pyrazol-5-ylboronic acid;hydrochloride (CAS 1314216-33-5) is a chemical compound with the molecular formula C3H6BClN2O2 and a molecular weight of 148.36 g/mol. IUPAC name: 1H-pyrazol-5-ylboronic acid;hydrochloride. InChIKey: YUVMFPRVYZDAPN-UHFFFAOYSA-N.

Identity
Molecular formulaC3H6BClN2O2
Molecular weight148.36 g/mol
IUPAC name1H-pyrazol-5-ylboronic acid;hydrochloride
InChIKeyYUVMFPRVYZDAPN-UHFFFAOYSA-N
SMILESB(C1=CC=NN1)(O)O.Cl

Computed by PubChem (NCBI)