Products 1314230-75-5
CAS 1314230-75-5 appears in our catalog under these names: 4–Quinolone–3–Carboxamide Furan CB2 Agonist, CB2 receptor agonist 2/ 98.07% (existing batch purity), N-(1-Adamantyl)-6-(furan-2-yl)-8-methoxy-4-oxo-1-pentylquinoline-3-carboxamide, 4-Quinolone-3-Carboxamide Furan CB2 Agonist, CB2 receptor agonist 2, 99.9%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 5 mg.
N-(1-adamantyl)-6-(furan-2-yl)-8-methoxy-4-oxo-1-pentylquinoline-3-carboxamide (CAS 1314230-75-5) is a chemical compound with the molecular formula C30H36N2O4 and a molecular weight of 488.6 g/mol. IUPAC name: N-(1-adamantyl)-6-(furan-2-yl)-8-methoxy-4-oxo-1-pentylquinoline-3-carboxamide. InChIKey: NXZZNXUALWSJSD-UHFFFAOYSA-N.
| Molecular formula | C30H36N2O4 |
|---|---|
| Molecular weight | 488.6 g/mol |
| IUPAC name | N-(1-adamantyl)-6-(furan-2-yl)-8-methoxy-4-oxo-1-pentylquinoline-3-carboxamide |
| InChIKey | NXZZNXUALWSJSD-UHFFFAOYSA-N |
| SMILES | CCCCCN1C=C(C(=O)C2=C1C(=CC(=C2)C3=CC=CO3)OC)C(=O)NC45CC6CC(C4)CC(C6)C5 |
Computed by PubChem (NCBI)