CAS 1314378-16-9 appears in our catalog under these names: Bis-PEG3-NHS Ester, 95%, Bis-PEG3-NHS Ester, Bis–PEG3–NHS ester, NHS-PEG(3)-NHS, Bis-PEG3-NHS ester 98%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Iris Biotech. Available pack sizes: 1g, 250mg, 5g, 100mg, 50mg, 500mg, 250 mg, 50 mg.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]propanoate (CAS 1314378-16-9) is a chemical compound with the molecular formula C18H24N2O11 and a molecular weight of 444.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]propanoate. InChIKey: OPGNUERFYQLUNP-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O11 |
|---|---|
| Molecular weight | 444.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]propanoate |
| InChIKey | OPGNUERFYQLUNP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)