CAS 1314639-66-1 appears in our catalog under these names: 4-(tert-Butyl)-2',6'-difluoro-2,3'-bipyridine, 98%, 4–(tert–Butyl)–2',6'–difluoro–2,3'–bipyridine. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g.
3-(4-tert-butyl-2-pyridinyl)-2,6-difluoropyridine (CAS 1314639-66-1) is a chemical compound with the molecular formula C14H14F2N2 and a molecular weight of 248.27 g/mol. IUPAC name: 3-(4-tert-butyl-2-pyridinyl)-2,6-difluoropyridine. InChIKey: BEHDTAWNZGEIFX-UHFFFAOYSA-N.
| Molecular formula | C14H14F2N2 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 3-(4-tert-butyl-2-pyridinyl)-2,6-difluoropyridine |
| InChIKey | BEHDTAWNZGEIFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NC=C1)C2=C(N=C(C=C2)F)F |
Computed by PubChem (NCBI)