CAS 1314660-89-3 appears in our catalog under these names: 2–(3–bromo–5–fluorophenyl)propan–2–amine hydrochloride, 2-(3-Bromo-5-fluorophenyl)propan-2-amine hydrochloride. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
2-(3-bromo-5-fluorophenyl)propan-2-amine (CAS 1314660-89-3) is a chemical compound with the molecular formula C9H11BrFN and a molecular weight of 232.09 g/mol. IUPAC name: 2-(3-bromo-5-fluorophenyl)propan-2-amine. InChIKey: MXYMFZUEJOULJD-UHFFFAOYSA-N.
| Molecular formula | C9H11BrFN |
|---|---|
| Molecular weight | 232.09 g/mol |
| IUPAC name | 2-(3-bromo-5-fluorophenyl)propan-2-amine |
| InChIKey | MXYMFZUEJOULJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC(=C1)Br)F)N |
Computed by PubChem (NCBI)