Products 1314663-93-8
CAS 1314663-93-8 appears in our catalog under these names: 2–(3–fluoro–4–methylphenyl)propan–2–amine hydrochloride, 2-(3-fluoro-4-methylphenyl)propan-2-amine. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-(3-fluoro-4-methylphenyl)propan-2-amine (CAS 1314663-93-8) is a chemical compound with the molecular formula C10H14FN and a molecular weight of 167.22 g/mol. IUPAC name: 2-(3-fluoro-4-methylphenyl)propan-2-amine. InChIKey: NZCTVHLUOYKOEL-UHFFFAOYSA-N.
| Molecular formula | C10H14FN |
|---|---|
| Molecular weight | 167.22 g/mol |
| IUPAC name | 2-(3-fluoro-4-methylphenyl)propan-2-amine |
| InChIKey | NZCTVHLUOYKOEL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)(C)N)F |
Computed by PubChem (NCBI)