CAS 1314781-26-4 appears in our catalog under these names: 2-(4-Bromo-3-fluorophenyl)propan-2-amine, 2–(4–bromo–3–fluorophenyl)propan–2–amine hydrochloride. Offered by: Chemat, GLPBio. Available pack sizes: 250mg, 1g, 5g.
2-(4-bromo-3-fluorophenyl)propan-2-amine (CAS 1314781-26-4) is a chemical compound with the molecular formula C9H11BrFN and a molecular weight of 232.09 g/mol. IUPAC name: 2-(4-bromo-3-fluorophenyl)propan-2-amine. InChIKey: NSLDIQTUGZUDSJ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrFN |
|---|---|
| Molecular weight | 232.09 g/mol |
| IUPAC name | 2-(4-bromo-3-fluorophenyl)propan-2-amine |
| InChIKey | NSLDIQTUGZUDSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)Br)F)N |
Computed by PubChem (NCBI)