Products 1314908-87-6

CAS 1314908-87-6 is the registry number for Methyl 2-Amino-3-furancarboxylic Acid Ester. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-aminofuran-3-carboxylate (CAS 1314908-87-6) is a chemical compound with the molecular formula C6H7NO3 and a molecular weight of 141.12 g/mol. IUPAC name: methyl 2-aminofuran-3-carboxylate. InChIKey: BDRJXTYTKMQHAH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO3
Molecular weight141.12 g/mol
IUPAC namemethyl 2-aminofuran-3-carboxylate
InChIKeyBDRJXTYTKMQHAH-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(OC=C1)N

Computed by PubChem (NCBI)