Products 1314929-56-0

CAS 1314929-56-0 is the registry number for Dacarbazine EP Impurity C. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-diazenyl-1H-imidazole-5-carboxamide (CAS 1314929-56-0) is a chemical compound with the molecular formula C4H5N5O and a molecular weight of 139.12 g/mol. IUPAC name: 4-diazenyl-1H-imidazole-5-carboxamide. InChIKey: IRJLFDHRTDDHFP-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5N5O
Molecular weight139.12 g/mol
IUPAC name4-diazenyl-1H-imidazole-5-carboxamide
InChIKeyIRJLFDHRTDDHFP-UHFFFAOYSA-N
SMILESC1=NC(=C(N1)C(=O)N)N=N

Computed by PubChem (NCBI)