CAS 1314988-10-7 is the registry number for 1-Benzyl-5-bromo-6-fluorobenzimidazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-benzyl-5-bromo-6-fluorobenzimidazole (CAS 1314988-10-7) is a chemical compound with the molecular formula C14H10BrFN2 and a molecular weight of 305.14 g/mol. IUPAC name: 1-benzyl-5-bromo-6-fluorobenzimidazole. InChIKey: WZHHXIVITKECOT-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFN2 |
|---|---|
| Molecular weight | 305.14 g/mol |
| IUPAC name | 1-benzyl-5-bromo-6-fluorobenzimidazole |
| InChIKey | WZHHXIVITKECOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC3=CC(=C(C=C32)F)Br |
Computed by PubChem (NCBI)