CAS 1314994-22-3 is the registry number for 1-Amino-2-nitro-ethenol Ammonium Salt. Offered by: TRC. Available pack sizes: 2,5g.
(Z)-1-amino-2-nitroethenol;azane (CAS 1314994-22-3) is a chemical compound with the molecular formula C2H7N3O3 and a molecular weight of 121.10 g/mol. IUPAC name: (Z)-1-amino-2-nitroethenol;azane. InChIKey: DHTLJTNOQAJITM-ODZAUARKSA-N.
| Molecular formula | C2H7N3O3 |
|---|---|
| Molecular weight | 121.10 g/mol |
| IUPAC name | (Z)-1-amino-2-nitroethenol;azane |
| InChIKey | DHTLJTNOQAJITM-ODZAUARKSA-N |
| SMILES | C(=C(/N)\O)\[N+](=O)[O-].N |
Computed by PubChem (NCBI)