CAS 1314999-78-4 is the registry number for Solriamfetol Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-3-phenylpropanal (CAS 1314999-78-4) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: (2R)-2-amino-3-phenylpropanal. InChIKey: CQIUZHAQYHXKRY-SECBINFHSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | (2R)-2-amino-3-phenylpropanal |
| InChIKey | CQIUZHAQYHXKRY-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C=O)N |
Computed by PubChem (NCBI)