CAS 131505-02-7 is the registry number for PD 130908. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2-bromoethyl)-3-(2-nitroimidazol-1-yl)propan-1-amine;hydrobromide (CAS 131505-02-7) is a chemical compound with the molecular formula C8H14Br2N4O2 and a molecular weight of 358.03 g/mol. IUPAC name: N-(2-bromoethyl)-3-(2-nitroimidazol-1-yl)propan-1-amine;hydrobromide. InChIKey: SZKHTAVHHLGWQG-UHFFFAOYSA-N.
| Molecular formula | C8H14Br2N4O2 |
|---|---|
| Molecular weight | 358.03 g/mol |
| IUPAC name | N-(2-bromoethyl)-3-(2-nitroimidazol-1-yl)propan-1-amine;hydrobromide |
| InChIKey | SZKHTAVHHLGWQG-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=N1)[N+](=O)[O-])CCCNCCBr.Br |
Computed by PubChem (NCBI)