CAS 1315312-71-0 is the registry number for 4-Bromobenzo[b]thiophene-3-carbonitrile, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-bromo-1-benzothiophene-3-carbonitrile (CAS 1315312-71-0) is a chemical compound with the molecular formula C9H4BrNS and a molecular weight of 238.11 g/mol. IUPAC name: 4-bromo-1-benzothiophene-3-carbonitrile. InChIKey: BCRWVCOLRPYCNX-UHFFFAOYSA-N.
| Molecular formula | C9H4BrNS |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 4-bromo-1-benzothiophene-3-carbonitrile |
| InChIKey | BCRWVCOLRPYCNX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CS2)C#N |
Computed by PubChem (NCBI)