CAS 1315326-77-2 is the registry number for 4-Chloro-2-(4-isopropoxyphenyl)benzofuro(3,2-d)pyrimidine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-2-(4-propan-2-yloxyphenyl)-[1]benzofuro[3,2-d]pyrimidine (CAS 1315326-77-2) is a chemical compound with the molecular formula C19H15ClN2O2 and a molecular weight of 338.8 g/mol. IUPAC name: 4-chloro-2-(4-propan-2-yloxyphenyl)-[1]benzofuro[3,2-d]pyrimidine. InChIKey: MKMYRAZSYGDDKS-UHFFFAOYSA-N.
| Molecular formula | C19H15ClN2O2 |
|---|---|
| Molecular weight | 338.8 g/mol |
| IUPAC name | 4-chloro-2-(4-propan-2-yloxyphenyl)-[1]benzofuro[3,2-d]pyrimidine |
| InChIKey | MKMYRAZSYGDDKS-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C2=NC3=C(C(=N2)Cl)OC4=CC=CC=C43 |
Computed by PubChem (NCBI)