Products 1315341-80-0
CAS 1315341-80-0 appears in our catalog under these names: 1-BOC-Indazole-3-boronic acid pinacol ester, 98%, tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate (CAS 1315341-80-0) is a chemical compound with the molecular formula C18H25BN2O4 and a molecular weight of 344.2 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate. InChIKey: NJYPEWHUZBKSQM-UHFFFAOYSA-N.
| Molecular formula | C18H25BN2O4 |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate |
| InChIKey | NJYPEWHUZBKSQM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C3=CC=CC=C23)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)