CAS 1315363-27-9 is the registry number for (3-Bromoimidazo(1,2-a)pyridin-8-yl)methanol, 97%. Offered by: AmBeed. Available pack sizes: 5g.
(3-bromoimidazo[1,2-a]pyridin-8-yl)methanol (CAS 1315363-27-9) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: (3-bromoimidazo[1,2-a]pyridin-8-yl)methanol. InChIKey: UWALRROTOZSRTI-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | (3-bromoimidazo[1,2-a]pyridin-8-yl)methanol |
| InChIKey | UWALRROTOZSRTI-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C(=C1)CO)Br |
Computed by PubChem (NCBI)