CAS 1315368-20-7 is the registry number for 2-Cyclopentylguanidine hemisulfate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
Bis(2-cyclopentylguanidine);sulfuric acid (CAS 1315368-20-7) is a chemical compound with the molecular formula C12H28N6O4S and a molecular weight of 352.46 g/mol. IUPAC name: bis(2-cyclopentylguanidine);sulfuric acid. InChIKey: DPEVNBIXVJRILX-UHFFFAOYSA-N.
| Molecular formula | C12H28N6O4S |
|---|---|
| Molecular weight | 352.46 g/mol |
| IUPAC name | bis(2-cyclopentylguanidine);sulfuric acid |
| InChIKey | DPEVNBIXVJRILX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N=C(N)N.C1CCC(C1)N=C(N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)