Products 1315379-60-2
CAS 1315379-60-2 appears in our catalog under these names: NPEC–caged–(1S,3R)–ACPD, NPEC-caged-(1S,3R)-ACPD. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, Get quote.
Trans-(1S,3R)-1-[1-(2-nitrophenyl)ethoxycarbonylamino]cyclopentane-1,3-dicarboxylic acid (CAS 1315379-60-2) is a chemical compound with the molecular formula C16H18N2O8 and a molecular weight of 366.32 g/mol. IUPAC name: trans-(1S,3R)-1-[1-(2-nitrophenyl)ethoxycarbonylamino]cyclopentane-1,3-dicarboxylic acid. InChIKey: SKBDCZAPZZBWJU-XOXYBHGNSA-N.
| Molecular formula | C16H18N2O8 |
|---|---|
| Molecular weight | 366.32 g/mol |
| IUPAC name | trans-(1S,3R)-1-[1-(2-nitrophenyl)ethoxycarbonylamino]cyclopentane-1,3-dicarboxylic acid |
| InChIKey | SKBDCZAPZZBWJU-XOXYBHGNSA-N |
| SMILES | CC(C1=CC=CC=C1[N+](=O)[O-])OC(=O)N[C@]2(CC[C@H](C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)