CAS 1315380-70-1 appears in our catalog under these names: VU591 hydrochloride/ 98.93% (existing batch purity), VU 591 hydrochloride, VU591 hydrochloride, ≥99%(HPLC), ≥99%(HPLC), VU591 hydrochloride, 99.0%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 50 mg.
6-nitro-2-[(6-nitro-1H-benzimidazol-2-yl)methoxymethyl]-1H-benzimidazole;hydrochloride (CAS 1315380-70-1) is a chemical compound with the molecular formula C16H13ClN6O5 and a molecular weight of 404.76 g/mol. IUPAC name: 6-nitro-2-[(6-nitro-1H-benzimidazol-2-yl)methoxymethyl]-1H-benzimidazole;hydrochloride. InChIKey: PXLOUHLPDHEXCC-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN6O5 |
|---|---|
| Molecular weight | 404.76 g/mol |
| IUPAC name | 6-nitro-2-[(6-nitro-1H-benzimidazol-2-yl)methoxymethyl]-1H-benzimidazole;hydrochloride |
| InChIKey | PXLOUHLPDHEXCC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC(=N2)COCC3=NC4=C(N3)C=C(C=C4)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)