CAS 1315476-05-1 appears in our catalog under these names: (5-Chloro-2-[(2,2-dimethylpropoxy)carbonyl]phenyl)boronic acid, 95%, (5–Chloro–2–((neopentyloxy)carbonyl)phenyl)boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
[5-chloro-2-(2,2-dimethylpropoxycarbonyl)phenyl]boronic acid (CAS 1315476-05-1) is a chemical compound with the molecular formula C12H16BClO4 and a molecular weight of 270.52 g/mol. IUPAC name: [5-chloro-2-(2,2-dimethylpropoxycarbonyl)phenyl]boronic acid. InChIKey: YTWKNWCOCNXTEX-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO4 |
|---|---|
| Molecular weight | 270.52 g/mol |
| IUPAC name | [5-chloro-2-(2,2-dimethylpropoxycarbonyl)phenyl]boronic acid |
| InChIKey | YTWKNWCOCNXTEX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)C(=O)OCC(C)(C)C)(O)O |
Computed by PubChem (NCBI)