CAS 1315590-90-9 is the registry number for tert-Butyl (2S,4R)-4-methoxy-2-((trityloxy)methyl)pyrrolidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,4R)-4-methoxy-2-(trityloxymethyl)pyrrolidine-1-carboxylate (CAS 1315590-90-9) is a chemical compound with the molecular formula C30H35NO4 and a molecular weight of 473.6 g/mol. IUPAC name: tert-butyl (2S,4R)-4-methoxy-2-(trityloxymethyl)pyrrolidine-1-carboxylate. InChIKey: WNTJCPIGBWITNC-RRPNLBNLSA-N.
| Molecular formula | C30H35NO4 |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | tert-butyl (2S,4R)-4-methoxy-2-(trityloxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | WNTJCPIGBWITNC-RRPNLBNLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1COC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)OC |
Computed by PubChem (NCBI)