Products 1315627-78-1
CAS 1315627-78-1 appears in our catalog under these names: Sodium 2-(acetylthio)ethane-1-sulfonate-1,1,2,2-d4, 2-Acetylthioethanesulfonic Acid-d4 Sodium Salt, >95% (HPLC), 2–Acetylthioethanesulfonic Acid–d4 Sodium Salt. Offered by: MedChemExpress, TRC, GLPBio. Available pack sizes: 25 mg, 5 mg, 10 mg, 25mg, 100mg.
Sodium 2-acetylsulfanyl-1,1,2,2-tetradeuterioethanesulfonate (CAS 1315627-78-1) is a chemical compound with the molecular formula C4H7NaO4S2 and a molecular weight of 210.2 g/mol. IUPAC name: sodium 2-acetylsulfanyl-1,1,2,2-tetradeuterioethanesulfonate. InChIKey: UJIOMPDETDVHAO-DAHDXRBSSA-M.
| Molecular formula | C4H7NaO4S2 |
|---|---|
| Molecular weight | 210.2 g/mol |
| IUPAC name | sodium 2-acetylsulfanyl-1,1,2,2-tetradeuterioethanesulfonate |
| InChIKey | UJIOMPDETDVHAO-DAHDXRBSSA-M |
| SMILES | [2H]C([2H])(C([2H])([2H])S(=O)(=O)[O-])SC(=O)C.[Na+] |
Computed by PubChem (NCBI)