CAS 1316-91-2 appears in our catalog under these names: Ferroceneacetonitrile, 95%, Ferroceneacetonitrile, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.
Cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylacetonitrile;iron(2+) (CAS 1316-91-2) is a chemical compound with the molecular formula C12H11FeN and a molecular weight of 225.07 g/mol. IUPAC name: cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylacetonitrile;iron(2+). InChIKey: TWXGKHRATKMJNK-UHFFFAOYSA-N.
| Molecular formula | C12H11FeN |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylacetonitrile;iron(2+) |
| InChIKey | TWXGKHRATKMJNK-UHFFFAOYSA-N |
| SMILES | [CH-]1C=CC=C1.[CH-]1C=CC=C1CC#N.[Fe+2] |
Computed by PubChem (NCBI)