CAS 131615-22-0 appears in our catalog under these names: (3R)-2,3-Dihydro-3-methyl-1h-isoindol-1-one, 95%, (R)–3–Methylisoindolin–1–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
(3R)-3-methyl-2,3-dihydroisoindol-1-one (CAS 131615-22-0) is a chemical compound with the molecular formula C9H9NO and a molecular weight of 147.17 g/mol. IUPAC name: (3R)-3-methyl-2,3-dihydroisoindol-1-one. InChIKey: VNPWIDIVQOFLQS-ZCFIWIBFSA-N.
| Molecular formula | C9H9NO |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (3R)-3-methyl-2,3-dihydroisoindol-1-one |
| InChIKey | VNPWIDIVQOFLQS-ZCFIWIBFSA-N |
| SMILES | C[C@@H]1C2=CC=CC=C2C(=O)N1 |
Computed by PubChem (NCBI)