Products 131615-52-6
CAS 131615-52-6 is the registry number for TISCH. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5R)-8-chloro-5-(3-iodophenyl)-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol (CAS 131615-52-6) is a chemical compound with the molecular formula C17H17ClINO and a molecular weight of 413.7 g/mol. IUPAC name: (5R)-8-chloro-5-(3-iodophenyl)-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol. InChIKey: DUTJKDUWCSYNLM-OAHLLOKOSA-N.
| Molecular formula | C17H17ClINO |
|---|---|
| Molecular weight | 413.7 g/mol |
| IUPAC name | (5R)-8-chloro-5-(3-iodophenyl)-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
| InChIKey | DUTJKDUWCSYNLM-OAHLLOKOSA-N |
| SMILES | CN1CCC2=CC(=C(C=C2[C@H](C1)C3=CC(=CC=C3)I)O)Cl |
Computed by PubChem (NCBI)