Products 1316221-91-6

CAS 1316221-91-6 is the registry number for 2-(2-Fluorophenyl)-2,3-dihydro-1H-indene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2-fluorophenyl)-1,3-dihydroindene-2-carboxylic acid (CAS 1316221-91-6) is a chemical compound with the molecular formula C16H13FO2 and a molecular weight of 256.27 g/mol. IUPAC name: 2-(2-fluorophenyl)-1,3-dihydroindene-2-carboxylic acid. InChIKey: DWDHROKIYXSPQB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13FO2
Molecular weight256.27 g/mol
IUPAC name2-(2-fluorophenyl)-1,3-dihydroindene-2-carboxylic acid
InChIKeyDWDHROKIYXSPQB-UHFFFAOYSA-N
SMILESC1C2=CC=CC=C2CC1(C3=CC=CC=C3F)C(=O)O

Computed by PubChem (NCBI)