CAS 1316275-52-1 is the registry number for 2-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzo[d]thiazole, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzothiazole (CAS 1316275-52-1) is a chemical compound with the molecular formula C19H20BNO2S and a molecular weight of 337.2 g/mol. IUPAC name: 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzothiazole. InChIKey: JCPQOSMRERCAOS-UHFFFAOYSA-N.
| Molecular formula | C19H20BNO2S |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzothiazole |
| InChIKey | JCPQOSMRERCAOS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3=NC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)