CAS 1316291-18-5 is the registry number for Pyruvic acid-d3 (sodium), 0.984%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg.
CAS 1316291-18-5 identifies a chemical compound with the molecular formula C3H4NaO3 and a molecular weight of 114.07 g/mol. InChIKey: DAQHMCWYXJEOCG-NIIDSAIPSA-N.
| Molecular formula | C3H4NaO3 |
|---|---|
| Molecular weight | 114.07 g/mol |
| InChIKey | DAQHMCWYXJEOCG-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C(=O)O.[Na] |
Computed by PubChem (NCBI)