CAS 13165-15-6 is the registry number for 7-Chloro-2,3-dihydro-3-phenyl-2-thioxo-1H-quinazolin-4-one. Offered by: Biosynth. Available pack sizes: 5g.
7-chloro-3-phenyl-2-sulfanylidene-1H-quinazolin-4-one (CAS 13165-15-6) is a chemical compound with the molecular formula C14H9ClN2OS and a molecular weight of 288.8 g/mol. IUPAC name: 7-chloro-3-phenyl-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: KPCPBBQBISDRFL-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2OS |
|---|---|
| Molecular weight | 288.8 g/mol |
| IUPAC name | 7-chloro-3-phenyl-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | KPCPBBQBISDRFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=C(C=C(C=C3)Cl)NC2=S |
Computed by PubChem (NCBI)