CAS 131707-23-8 appears in our catalog under these names: Arbidol hydrochloride, 95%, Arbidol HCl, Arbidol, Arbidol Hydrochloride, >95% (HPLC), Arbidol, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, TargetMol. Available pack sizes: 1g, 250mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate;hydrochloride (CAS 131707-23-8) is a chemical compound with the molecular formula C22H26BrClN2O3S and a molecular weight of 513.9 g/mol. IUPAC name: ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate;hydrochloride. InChIKey: OMZHXQXQJGCSKN-UHFFFAOYSA-N.
| Molecular formula | C22H26BrClN2O3S |
|---|---|
| Molecular weight | 513.9 g/mol |
| IUPAC name | ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate;hydrochloride |
| InChIKey | OMZHXQXQJGCSKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C2=CC(=C(C(=C21)CN(C)C)O)Br)C)CSC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)