CAS 131717-99-2 appears in our catalog under these names: Bis(4-tert-butylphenyl)iodonium p-toluenesulfonate, 95%, Bis(4–tert–butylphenyl)iodoniump–toluenesulfonate, Bis(4-tert-butylphenyl)iodonium p-toluenesulfonate, Electron, IODONIUM, BIS[(1,1-DIMETHYLETHYL)PHENYL]-, 4-METHYLBENZENESULFONATE (1:1), 99%+ trace metals basis,EL, 99%+ trace metals basis,EL. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 5g, 250mg, 1g, 50mg, 100mg.
Bis(4-tert-butylphenyl)iodanium;4-methylbenzenesulfonate (CAS 131717-99-2) is a chemical compound with the molecular formula C27H33IO3S and a molecular weight of 564.5 g/mol. IUPAC name: bis(4-tert-butylphenyl)iodanium;4-methylbenzenesulfonate. InChIKey: UEJFJTOGXLEPIV-UHFFFAOYSA-M.
| Molecular formula | C27H33IO3S |
|---|---|
| Molecular weight | 564.5 g/mol |
| IUPAC name | bis(4-tert-butylphenyl)iodanium;4-methylbenzenesulfonate |
| InChIKey | UEJFJTOGXLEPIV-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].CC(C)(C)C1=CC=C(C=C1)[I+]C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)