CAS 131733-92-1 appears in our catalog under these names: NCS-382, Sodium Salt, NCS-382 sodium, 98+%, NCS–382 (sodium salt), NCS-382 sodium, NCS-382, Sodium Salt. Offered by: TRC, AmBeed, GLPBio, TargetMol, Chemat. Available pack sizes: 250mg, 50mg, 10mg, 100mg, 500mg, 5 mg, 1 mg.
Sodium 2-(5-hydroxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylidene)acetate (CAS 131733-92-1) is a chemical compound with the molecular formula C13H13NaO3 and a molecular weight of 240.23 g/mol. IUPAC name: sodium 2-(5-hydroxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylidene)acetate. InChIKey: BTWDZCORIHHOPO-UHFFFAOYSA-M.
| Molecular formula | C13H13NaO3 |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | sodium 2-(5-hydroxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylidene)acetate |
| InChIKey | BTWDZCORIHHOPO-UHFFFAOYSA-M |
| SMILES | C1CC2=CC=CC=C2C(C(=CC(=O)[O-])C1)O.[Na+] |
Computed by PubChem (NCBI)