CAS 131787-39-8 appears in our catalog under these names: 2,5-Dimethylhexane-2,5-diyl bis(2-methylacrylate) 98%, 2,5-Dimethylhexane-2,5-diyl bis(2-methylacrylate), 98%, 98%, 2,5-Dimethylhexane-2,5-diylbis(2-methylacrylate), 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
[2,5-dimethyl-5-(2-methylprop-2-enoyloxy)hexan-2-yl] 2-methylprop-2-enoate (CAS 131787-39-8) is a chemical compound with the molecular formula C16H26O4 and a molecular weight of 282.37 g/mol. IUPAC name: [2,5-dimethyl-5-(2-methylprop-2-enoyloxy)hexan-2-yl] 2-methylprop-2-enoate. InChIKey: KCBQMPUZDSXZOQ-UHFFFAOYSA-N.
| Molecular formula | C16H26O4 |
|---|---|
| Molecular weight | 282.37 g/mol |
| IUPAC name | [2,5-dimethyl-5-(2-methylprop-2-enoyloxy)hexan-2-yl] 2-methylprop-2-enoate |
| InChIKey | KCBQMPUZDSXZOQ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC(C)(C)CCC(C)(C)OC(=O)C(=C)C |
Computed by PubChem (NCBI)