CAS 131842-75-6 is the registry number for Isopropylaminosulfoni-d7 Acid. Offered by: TRC. Available pack sizes: 100mg.
N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)sulfamoyl chloride (CAS 131842-75-6) is a chemical compound with the molecular formula C3H8ClNO2S and a molecular weight of 164.66 g/mol. IUPAC name: N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)sulfamoyl chloride. InChIKey: AGRDPCWQGGNEQL-YYWVXINBSA-N.
| Molecular formula | C3H8ClNO2S |
|---|---|
| Molecular weight | 164.66 g/mol |
| IUPAC name | N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)sulfamoyl chloride |
| InChIKey | AGRDPCWQGGNEQL-YYWVXINBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NS(=O)(=O)Cl |
Computed by PubChem (NCBI)