CAS 131844-29-6 is the registry number for Trans-2-(2-chlorophenyl)cyclopropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2S)-2-(2-chlorophenyl)cyclopropan-1-amine (CAS 131844-29-6) is a chemical compound with the molecular formula C9H10ClN and a molecular weight of 167.63 g/mol. IUPAC name: trans-(1R,2S)-2-(2-chlorophenyl)cyclopropan-1-amine. InChIKey: RTSGJRWDGWWLFL-IONNQARKSA-N.
| Molecular formula | C9H10ClN |
|---|---|
| Molecular weight | 167.63 g/mol |
| IUPAC name | trans-(1R,2S)-2-(2-chlorophenyl)cyclopropan-1-amine |
| InChIKey | RTSGJRWDGWWLFL-IONNQARKSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)