CAS 13186-19-1 is the registry number for 6-O-Galloylglucose. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] 3,4,5-trihydroxybenzoate (CAS 13186-19-1) is a chemical compound with the molecular formula C13H16O10 and a molecular weight of 332.26 g/mol. IUPAC name: [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] 3,4,5-trihydroxybenzoate. InChIKey: SMZJCCHIPATQCN-LUTQBAROSA-N.
| Molecular formula | C13H16O10 |
|---|---|
| Molecular weight | 332.26 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] 3,4,5-trihydroxybenzoate |
| InChIKey | SMZJCCHIPATQCN-LUTQBAROSA-N |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OC[C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O |
Computed by PubChem (NCBI)