CAS 131880-16-5 appears in our catalog under these names: 5–(Trifluoromethyl)dibenzothiophenium tetrafluoroborate, 5-(TRIFLUOROMETHYL)DIBENZOTHIOPHENIUM TE, 5-(Trifluoromethyl)dibenzothiophenium tetrafluoroborate, 95%, 5-(Trifluoromethyl)dibenzothiophenium Tetrafluoroborate, 95%, 95%, Umemoto Reagent I 95%. Offered by: GLPBio, Sigma-Aldrich, Fluorochem, Chemat, Ambeed. Available pack sizes: 1g, 200mg, 5g, 250mg, 10g, 25g, 100mg.
5-(trifluoromethyl)dibenzothiophen-5-ium tetrafluoroborate (CAS 131880-16-5) is a chemical compound with the molecular formula C13H8BF7S and a molecular weight of 340.07 g/mol. IUPAC name: 5-(trifluoromethyl)dibenzothiophen-5-ium tetrafluoroborate. InChIKey: VTVISWLINKWMQZ-UHFFFAOYSA-N.
| Molecular formula | C13H8BF7S |
|---|---|
| Molecular weight | 340.07 g/mol |
| IUPAC name | 5-(trifluoromethyl)dibenzothiophen-5-ium tetrafluoroborate |
| InChIKey | VTVISWLINKWMQZ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C2C(=C1)C3=CC=CC=C3[S+]2C(F)(F)F |
Computed by PubChem (NCBI)