CAS 131887-51-9 appears in our catalog under these names: (R)-2-Benzylmorpholine, 95%, (R)–2–Benzylmorpholine, (R)-2-Benzylmorpholine, 95%, 95%, (R)-2-Benzylmorpholine, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 200mg.
(2R)-2-benzylmorpholine (CAS 131887-51-9) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: (2R)-2-benzylmorpholine. InChIKey: YZFCMGWCEXUGFX-LLVKDONJSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | (2R)-2-benzylmorpholine |
| InChIKey | YZFCMGWCEXUGFX-LLVKDONJSA-N |
| SMILES | C1CO[C@@H](CN1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)