CAS 1318897-45-8 is the registry number for 7-Bromo-3-isoquinolinemethanol. Offered by: TRC. Available pack sizes: 500mg.
(7-bromoisoquinolin-3-yl)methanol (CAS 1318897-45-8) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: (7-bromoisoquinolin-3-yl)methanol. InChIKey: HUUUWNGVOTYHFB-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | (7-bromoisoquinolin-3-yl)methanol |
| InChIKey | HUUUWNGVOTYHFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CN=C(C=C21)CO)Br |
Computed by PubChem (NCBI)