Products 131927-00-9
CAS 131927-00-9 is the registry number for AG-1909. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfonyl]-3H-benzimidazol-5-ol (CAS 131927-00-9) is a chemical compound with the molecular formula C16H14F3N3O4S and a molecular weight of 401.4 g/mol. IUPAC name: 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfonyl]-3H-benzimidazol-5-ol. InChIKey: FJCXMOYNXRDYCX-UHFFFAOYSA-N.
| Molecular formula | C16H14F3N3O4S |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfonyl]-3H-benzimidazol-5-ol |
| InChIKey | FJCXMOYNXRDYCX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)(=O)C2=NC3=C(N2)C=C(C=C3)O)OCC(F)(F)F |
Computed by PubChem (NCBI)