CAS 13195-79-4 appears in our catalog under these names: 2,2,4'-Tribromoacetophenone, 95%, ±,±,p-Tribromoacetophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 25g, 10g.
2,2-dibromo-1-(4-bromophenyl)ethanone (CAS 13195-79-4) is a chemical compound with the molecular formula C8H5Br3O and a molecular weight of 356.84 g/mol. IUPAC name: 2,2-dibromo-1-(4-bromophenyl)ethanone. InChIKey: KFTUNOVZJWIKFX-UHFFFAOYSA-N.
| Molecular formula | C8H5Br3O |
|---|---|
| Molecular weight | 356.84 g/mol |
| IUPAC name | 2,2-dibromo-1-(4-bromophenyl)ethanone |
| InChIKey | KFTUNOVZJWIKFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(Br)Br)Br |
Computed by PubChem (NCBI)