Products 13195-79-4

CAS 13195-79-4 appears in our catalog under these names: 2,2,4'-Tribromoacetophenone, 95%, ±,±,p-Tribromoacetophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

2,2-dibromo-1-(4-bromophenyl)ethanone (CAS 13195-79-4) is a chemical compound with the molecular formula C8H5Br3O and a molecular weight of 356.84 g/mol. IUPAC name: 2,2-dibromo-1-(4-bromophenyl)ethanone. InChIKey: KFTUNOVZJWIKFX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5Br3O
Molecular weight356.84 g/mol
IUPAC name2,2-dibromo-1-(4-bromophenyl)ethanone
InChIKeyKFTUNOVZJWIKFX-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)C(Br)Br)Br

Computed by PubChem (NCBI)