CAS 1319716-41-0 appears in our catalog under these names: 2-Azaspiro[4.4]nonane-2-carboxylic acid, 7-hydroxy-, 1,1-dimethylethyl ester, 95%, 2-azaspiro(4.4)nonane-2-carboxylic acid, 7-hydroxy-, 1,1-dimethylethyl ester, tert-Butyl 7-hydroxy-2-azaspiro[4.4]nonane-2-carboxylate, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 10g, 1g, 5g, 0,1g, 0,25g, 0,5g.
Tert-butyl 8-hydroxy-2-azaspiro[4.4]nonane-2-carboxylate (CAS 1319716-41-0) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl 8-hydroxy-2-azaspiro[4.4]nonane-2-carboxylate. InChIKey: MUMPVHCQFGQIKY-UHFFFAOYSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl 8-hydroxy-2-azaspiro[4.4]nonane-2-carboxylate |
| InChIKey | MUMPVHCQFGQIKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCC(C2)O |
Computed by PubChem (NCBI)