CAS 1319723-22-2 appears in our catalog under these names: 1-(Methyl-d3)piperazine-2,2,3,3,5,5,6,6-d8, N-Methyl-d3-piperazine-2,2,3,3,5,5,6,6-d8, 99 atom % D, min 98% Chemical Purity, N–Methylpiperazine–d11, N-Methylpiperazine-d11, 98.00%. Offered by: Chemat Brand, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 0,25g, 0,1g, 10mg, 5mg, 25 mg, 100 mg, 50 mg.
2,2,3,3,5,5,6,6-octadeuterio-1-(trideuteriomethyl)piperazine (CAS 1319723-22-2) is a chemical compound with the molecular formula C5H12N2 and a molecular weight of 111.23 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuterio-1-(trideuteriomethyl)piperazine. InChIKey: PVOAHINGSUIXLS-GILSBCIXSA-N.
| Molecular formula | C5H12N2 |
|---|---|
| Molecular weight | 111.23 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuterio-1-(trideuteriomethyl)piperazine |
| InChIKey | PVOAHINGSUIXLS-GILSBCIXSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C([2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)