CAS 132-69-4 appears in our catalog under these names: Benzydamine HCl, Benzydamine Hydrochloride, >95% (HPLC), Benzydamine Hydrochloride, Benzydamine HCl, Benzydamine hydrochloride . Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, GLPBio. Available pack sizes: on request, 10g, 1g, 50mg, 250mg, 10mg, 10mM (in 1ml dmso), 5g.
3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;hydrochloride (CAS 132-69-4) is a chemical compound with the molecular formula C19H24ClN3O and a molecular weight of 345.9 g/mol. IUPAC name: 3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;hydrochloride. InChIKey: HNNIWKQLJSNAEQ-UHFFFAOYSA-N.
| Molecular formula | C19H24ClN3O |
|---|---|
| Molecular weight | 345.9 g/mol |
| IUPAC name | 3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;hydrochloride |
| InChIKey | HNNIWKQLJSNAEQ-UHFFFAOYSA-N |
| SMILES | CN(C)CCCOC1=NN(C2=CC=CC=C21)CC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)