CAS 132-86-5 appears in our catalog under these names: 1,3-Naphthalenediol, >95% (HPLC), Naphthoresorcinol, Naphthoresorcinol/ 99.56% (existing batch purity), 1,3-Dihydroxynaphthalene, 98% , 1,3-Dihydroxynaphthalene. Offered by: TRC, GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 500mg, 1g, 5g, 25g, 50g, 100g, 250g, 500g.
Naphthalene-1,3-diol (CAS 132-86-5) is a chemical compound with the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. IUPAC name: naphthalene-1,3-diol. InChIKey: XOOMNEFVDUTJPP-UHFFFAOYSA-N.
| Molecular formula | C10H8O2 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | naphthalene-1,3-diol |
| InChIKey | XOOMNEFVDUTJPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2O)O |
Computed by PubChem (NCBI)