CAS 132-87-6 appears in our catalog under these names: 7-Benzamido-4-hydroxynaphthalene-2-sulfonic acid, 95%, 7-Benzamido-4-hydroxynaphthalene-2-sulfonic acid, 95+%, 7-Benzamido-4-hydroxynaphthalene-2-sulfonic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg.
7-benzamido-4-hydroxynaphthalene-2-sulfonic acid (CAS 132-87-6) is a chemical compound with the molecular formula C17H13NO5S and a molecular weight of 343.4 g/mol. IUPAC name: 7-benzamido-4-hydroxynaphthalene-2-sulfonic acid. InChIKey: ZLHGMJOGMLVDFS-UHFFFAOYSA-N.
| Molecular formula | C17H13NO5S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 7-benzamido-4-hydroxynaphthalene-2-sulfonic acid |
| InChIKey | ZLHGMJOGMLVDFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC3=CC(=CC(=C3C=C2)O)S(=O)(=O)O |
Computed by PubChem (NCBI)