CAS 1320211-70-8 appears in our catalog under these names: R-Pralatrexate, Pralatrexate, (R)-, (R)-Pralatrexate. Offered by: Chemat Brand, TargetMol, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 100mg, Get quote.
(2S)-2-[[4-[(2R)-1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl]amino]pentanedioic acid (CAS 1320211-70-8) is a chemical compound with the molecular formula C23H23N7O5 and a molecular weight of 477.5 g/mol. IUPAC name: (2S)-2-[[4-[(2R)-1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl]amino]pentanedioic acid. InChIKey: OGSBUKJUDHAQEA-ZBFHGGJFSA-N.
| Molecular formula | C23H23N7O5 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | (2S)-2-[[4-[(2R)-1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl]amino]pentanedioic acid |
| InChIKey | OGSBUKJUDHAQEA-ZBFHGGJFSA-N |
| SMILES | C#CC[C@H](CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)